methyl 1,2,3,4,6,7,8,8a-octahydro-2,8,8-trimethyl-2-naphthoate
Modify Date: 2025-09-13 18:26:19
methyl 1,2,3,4,6,7,8,8a-octahydro-2,8,8-trimethyl-2-naphthoate structure
|
Common Name | methyl 1,2,3,4,6,7,8,8a-octahydro-2,8,8-trimethyl-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 93892-58-1 | Molecular Weight | 236.35000 | |
| Density | 0.99g/cm3 | Boiling Point | 296.9ºC at 760mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.9ºC | |
| Name | methyl 2,8,8-trimethyl-1,3,4,6,7,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 296.9ºC at 760mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 125.9ºC |
| Exact Mass | 236.17800 |
| PSA | 26.30000 |
| LogP | 3.71220 |
| Index of Refraction | 1.495 |
| InChIKey | ZMXFFZBRNBVZAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)CCC2=CCCC(C)(C)C2C1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,8,8-Trimethyl-1,2,3,4,6,7,8,8a-octahydro-[2]naphthoesaeure-methylester |
| EINECS 299-543-6 |
| 2,8,8-trimethyl-1,2,3,4,6,7,8,8a-octahydro-[2]naphthoic acid methyl ester |
| Methyl 1,2,3,4,6,7,8,8a-octahydro-2,8,8-trimethyl-2-naphthoate |