naphthalene-2-sulphonic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | naphthalene-2-sulphonic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93892-13-8 | Molecular Weight | 269.31700 | |
| Density | N/A | Boiling Point | 565.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.7ºC | |
| Name | 2-aminoethanol,naphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 565.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.31700 |
| Flash Point | 295.7ºC |
| Exact Mass | 269.07200 |
| PSA | 109.00000 |
| LogP | 2.80500 |
| InChIKey | PZYIRBNZDZVZKP-UHFFFAOYSA-N |
| SMILES | NCCO.O=S(=O)(O)c1ccc2ccccc2c1 |
| EINECS 299-494-0 |
| Naphthalene-2-sulphonic acid,compound with 2-aminoethanol (1:1) |