7-(1-ethoxyethoxy)-3,7-dimethyloctanal
Modify Date: 2025-09-26 20:50:34
7-(1-ethoxyethoxy)-3,7-dimethyloctanal structure
|
Common Name | 7-(1-ethoxyethoxy)-3,7-dimethyloctanal | ||
|---|---|---|---|---|
| CAS Number | 93858-99-2 | Molecular Weight | 244.37000 | |
| Density | 0.903g/cm3 | Boiling Point | 300.2ºC at 760mmHg | |
| Molecular Formula | C14H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.2ºC | |
| Name | 7-(1-ethoxyethoxy)-3,7-dimethyloctanal |
|---|---|
| Synonym | More Synonyms |
| Density | 0.903g/cm3 |
|---|---|
| Boiling Point | 300.2ºC at 760mmHg |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37000 |
| Flash Point | 126.2ºC |
| Exact Mass | 244.20400 |
| PSA | 35.53000 |
| LogP | 3.55950 |
| Index of Refraction | 1.434 |
| InChIKey | WFYJZJGLGJDJFM-UHFFFAOYSA-N |
| SMILES | CCOC(C)OC(C)(C)CCCC(C)CC=O |
| HS Code | 2912499000 |
|---|
|
~%
7-(1-ethoxyetho... CAS#:93858-99-2 |
| Literature: Alquier Bulletin de la Societe Chimique de France, 1943 , vol. <5> 10, p. 197 |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 7-(1-Aethoxy-aethoxy)-3,7-dimethyl-octanal |
| Hydroxycitronellal-(1-aethoxy-aethylaether) |
| 7-(1-ethoxy-ethoxy)-3,7-dimethyl-octanal |
| EINECS 299-335-5 |