ethyltriphenylphosphonium, salt with 4-bromo-2,6-xylenol (1:1) structure
|
Common Name | ethyltriphenylphosphonium, salt with 4-bromo-2,6-xylenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93841-02-2 | Molecular Weight | 491.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28BrOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-2,6-dimethylphenolate,ethyl(triphenyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H28BrOP |
|---|---|
| Molecular Weight | 491.39900 |
| Exact Mass | 490.10600 |
| PSA | 36.65000 |
| LogP | 7.21010 |
| InChIKey | IDKGQVCGJOYSNK-UHFFFAOYSA-M |
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cc1cc(Br)cc(C)c1[O-] |
| EINECS 298-971-0 |
| Ethyltriphenylphosphonium,salt with 4-bromo-2,6-xylenol (1:1) |