benzyltriphenylphosphonium, salt with 5-chloro-2-(2,4-dichlorophenoxy)phenol (1:1) structure
|
Common Name | benzyltriphenylphosphonium, salt with 5-chloro-2-(2,4-dichlorophenoxy)phenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93839-57-7 | Molecular Weight | 641.95000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H28Cl3O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl(triphenyl)phosphanium,5-chloro-2-(2,4-dichlorophenoxy)phenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C37H28Cl3O2P |
|---|---|
| Molecular Weight | 641.95000 |
| Exact Mass | 640.08900 |
| PSA | 45.88000 |
| LogP | 10.76360 |
| InChIKey | ZPDLQXKVHCHSDA-UHFFFAOYSA-M |
| SMILES | [O-]c1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| EINECS 298-828-2 |
| Benzyltriphenylphosphonium,salt with 5-chloro-2-(2,4-dichlorophenoxy)phenol (1:1) |