methyltriphenylphosphonium, salt with 2-cyclohexylphenol (1:1) structure
|
Common Name | methyltriphenylphosphonium, salt with 2-cyclohexylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93839-52-2 | Molecular Weight | 452.56700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H33OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexylphenolate,methyl(triphenyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H33OP |
|---|---|
| Molecular Weight | 452.56700 |
| Exact Mass | 452.22700 |
| PSA | 36.65000 |
| LogP | 7.48840 |
| InChIKey | GZXCFGHBJLLRCA-UHFFFAOYSA-M |
| SMILES | C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.C1CCC(CC1)C2=CC=CC=C2[O-] |
| EINECS 298-824-0 |
| Methyltriphenylphosphonium,salt with 2-cyclohexylphenol (1:1) |