methyl 2-azido-2-(phenylhydrazinylidene)acetate structure
|
Common Name | methyl 2-azido-2-(phenylhydrazinylidene)acetate | ||
|---|---|---|---|---|
| CAS Number | 93831-03-9 | Molecular Weight | 219.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-azido-2-(phenylhydrazinylidene)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9N5O2 |
|---|---|
| Molecular Weight | 219.20000 |
| Exact Mass | 219.07600 |
| PSA | 100.44000 |
| LogP | 1.42106 |
| InChIKey | ABNOQNKWQCTRGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N=[N+]=[N-])=NNc1ccccc1 |
|
~58%
methyl 2-azido-... CAS#:93831-03-9 |
| Literature: Bruche, Luca; Garanti, Luisa; Zecchi, Gaetano Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 7 p. 1427 - 1429 |
| Methyl azido-(phenylhydrazono)-acetate |
| Acetic acid,azido(phenylhydrazono)-,methyl ester |