2-[5-[5-(4-bromophenyl)furan-2-yl]tetrazol-2-yl]acetic acid structure
|
Common Name | 2-[5-[5-(4-bromophenyl)furan-2-yl]tetrazol-2-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 93789-17-4 | Molecular Weight | 349.14000 | |
| Density | 1.79g/cm3 | Boiling Point | 587.4ºC at 760 mmHg | |
| Molecular Formula | C13H9BrN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.1ºC | |
| Name | 2-[5-[5-(4-bromophenyl)furan-2-yl]tetrazol-2-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 587.4ºC at 760 mmHg |
| Molecular Formula | C13H9BrN4O3 |
| Molecular Weight | 349.14000 |
| Flash Point | 309.1ºC |
| Exact Mass | 347.98600 |
| PSA | 94.04000 |
| LogP | 2.44720 |
| Index of Refraction | 1.739 |
| InChIKey | JFXNNAISANQOEB-UHFFFAOYSA-N |
| SMILES | O=C(O)Cn1nnc(-c2ccc(-c3ccc(Br)cc3)o2)n1 |
|
~91%
2-[5-[5-(4-brom... CAS#:93789-17-4 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
|
~%
2-[5-[5-(4-brom... CAS#:93789-17-4 |
| Literature: Janda; Voticky; Jakubcova; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 7 p. 1699 - 1712 |
| 5-(5-(4-BROMOPHENYL)-FURAN-2-YL)-2H-TETRAZOLE-2-ACETIC ACID |
| 2H-Tetrazole-2-acetic acid,5-(5-(4-bromophenyl)-2-furanyl) |
| 5-(5-(4-Bromophenyl)-2-furanyl)-2H-tetrazole-2-acetic acid |