4'-isopropyl-4-methoxychalcone
Modify Date: 2025-09-18 16:55:59
4'-isopropyl-4-methoxychalcone structure
|
Common Name | 4'-isopropyl-4-methoxychalcone | ||
|---|---|---|---|---|
| CAS Number | 93777-34-5 | Molecular Weight | 280.36100 | |
| Density | 1.062g/cm3 | Boiling Point | 433ºC at 760 mmHg | |
| Molecular Formula | C19H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | 3-(4-methoxyphenyl)-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760 mmHg |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.36100 |
| Flash Point | 185.3ºC |
| Exact Mass | 280.14600 |
| PSA | 26.30000 |
| LogP | 4.71470 |
| Index of Refraction | 1.581 |
| InChIKey | DUPLPFCNUBOQMC-AWNIVKPZSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccc(C(C)C)cc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~%
4'-isopropyl-4-... CAS#:93777-34-5 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 982,994 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4'-Isopropyl-4-methoxychalcone |
| 4'-isopropyl-4-methoxy-trans-chalcone |
| 4'-Isopropyl-4-methoxy-trans-chalkon |