(1S)-2-Oxobornane-10-sulphonic acid, compound with 1,3,5,7-tetraazatricyclo(3.3.1.13,7)decane (1:1)
Modify Date: 2025-09-22 14:05:51
(1S)-2-Oxobornane-10-sulphonic acid, compound with 1,3,5,7-tetraazatricyclo(3.3.1.13,7)decane (1:1) structure
|
Common Name | (1S)-2-Oxobornane-10-sulphonic acid, compound with 1,3,5,7-tetraazatricyclo(3.3.1.13,7)decane (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93777-05-0 | Molecular Weight | 372.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1S)-2-Oxobornane-10-sulphonic acid, compound with 1,3,5,7-tetraazatricyclo(3.3.1.13,7)decane (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H28N4O4S |
|---|---|
| Molecular Weight | 372.48300 |
| Exact Mass | 372.18300 |
| PSA | 92.78000 |
| LogP | 1.08220 |
| InChIKey | AXEFIGHWTZPXOH-DLGLCQKISA-N |
| SMILES | C1N2CN3CN1CN(C2)C3.CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2 |
| einecs 298-033-0 |