4-[(2-Amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)benzonitrile structure
|
Common Name | 4-[(2-Amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 937629-00-0 | Molecular Weight | 283.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-Amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)benzonitrile |
|---|
| Molecular Formula | C12H8F3N3S |
|---|---|
| Molecular Weight | 283.27 |
| InChIKey | RREGAHBRLATPIC-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Cc2cnc(N)s2)c(C(F)(F)F)c1 |
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|