1-(4-Trifluoromethoxyphenyl)-1-carboxycyclopropane structure
|
Common Name | 1-(4-Trifluoromethoxyphenyl)-1-carboxycyclopropane | ||
|---|---|---|---|---|
| CAS Number | 936727-93-4 | Molecular Weight | 246.183 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 304.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.7±27.9 °C | |
| Name | 1-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.1±42.0 °C at 760 mmHg |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.183 |
| Flash Point | 137.7±27.9 °C |
| Exact Mass | 246.050385 |
| PSA | 46.53000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | WLYQHMMKMYCFAP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(OC(F)(F)F)cc2)CC1 |
|
~%
1-(4-Trifluorom... CAS#:936727-93-4 |
| Literature: Taisho Pharmaceutical Co. Ltd.; Nissan Chemical Industries, Ltd. Patent: EP2003131 A1, 2008 ; Location in patent: Page/Page column 76 ; EP 2003131 A1 |
|
~%
1-(4-Trifluorom... CAS#:936727-93-4 |
| Literature: Richards, Steven; Larson, Christopher J.; Koltun, Elena S.; Hanel, Art; Chan, Vicky; Nachtigall, Jason; Harrison, Amanda; Aay, Naing; Du, Hongwang; Arcalas, Arlyn; Galan, Adam; Zhang, Jeff; Zhang, Wentao; Won, Kwang-Ai; Tam, Danny; Qian, Fawn; Wang, Tao; Finn, Patricia; Ogilvie, Kathy; Rosen, Jon; Aoyama, Ron; Plonowski, Artur; Cancilla, Belinda; Bentzien, Frauke; Yakes, Michael; Mohan, Raju; Lamb, Peter; Nuss, John; Kearney, Patrick Journal of Medicinal Chemistry, 2012 , vol. 55, # 9 p. 4322 - 4335 |
| 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid |
| 1-[4-(Trifluoromethoxy)phenyl]cyclopropanecarboxylic acid |
| y4765 |
| Cyclopropanecarboxylic acid, 1-[4-(trifluoromethoxy)phenyl]- |
| 1-(4-Trifluoromethoxyphenyl)-1-carboxycyclopropane |