Benzyl (1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl)(phenyl)carbamate
Modify Date: 2025-08-25 09:16:40
Benzyl (1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl)(phenyl)carbamate structure
|
Common Name | Benzyl (1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl)(phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 936498-12-3 | Molecular Weight | 442.549 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 587.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C28H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.3±30.1 °C | |
| Name | Benzyl (1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl)(phenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 587.9±50.0 °C at 760 mmHg |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.549 |
| Flash Point | 309.3±30.1 °C |
| Exact Mass | 442.225647 |
| PSA | 49.85000 |
| LogP | 6.28 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | MFTMGXVFBCJAAM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)N1CCC(N(C(=O)OCc2ccccc2)c2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl N-[1-(1-oxo-1-phenylpropan-2-yl)piperidin-4-yl]-N-phenylcarbamate |
| Carbamic acid, N-[1-(1-methyl-2-oxo-2-phenylethyl)-4-piperidinyl]-N-phenyl-, phenylmethyl ester |
| Benzyl [1-(1-oxo-1-phenyl-2-propanyl)-4-piperidinyl]phenylcarbamate |