Carbamic acid,(3-bromopropionyl)-, 1-naphthyl ester (7CI)
Modify Date: 2024-01-16 18:23:53
Carbamic acid,(3-bromopropionyl)-, 1-naphthyl ester (7CI) structure
|
Common Name | Carbamic acid,(3-bromopropionyl)-, 1-naphthyl ester (7CI) | ||
|---|---|---|---|---|
| CAS Number | 93647-60-0 | Molecular Weight | 322.15400 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalen-1-yl (3-bromopropanoyl)carbamate |
|---|
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.15400 |
| Exact Mass | 321.00000 |
| PSA | 55.40000 |
| LogP | 3.63070 |
| Index of Refraction | 1.631 |
| InChIKey | JGXUSBQBRKEIHG-UHFFFAOYSA-N |
| SMILES | O=C(CCBr)NC(=O)Oc1cccc2ccccc12 |
|
~%
Carbamic acid,(... CAS#:93647-60-0 |
| Literature: Johnson,H.W. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 1416 - 1417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |