tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate
tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate structure
|
Common Name | tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 936361-25-0 | Molecular Weight | 214.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N2O2S |
|---|---|
| Molecular Weight | 214.28500 |
| Exact Mass | 214.07800 |
| PSA | 82.95000 |
| LogP | 2.81210 |
| InChIKey | LTEBHMFRYPZULH-UHFFFAOYSA-N |
| SMILES | Cc1ncc(NC(=O)OC(C)(C)C)s1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934100090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is 214.28500. |
| Q: What is the SMILES notation of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is Cc1ncc(NC(=O)OC(C)(C)C)s1. |
| Q: What is the CAS number of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: CAS number of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is 936361-25-0. |
| Q: What is the InChIKey of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: InChIKey of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is LTEBHMFRYPZULH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is C9H14N2O2S. |
| Q: What is the English name of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: The English name of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate. |
| Q: What is the LogP of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: LogP of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is 2.81210. |
| Q: What is the Chinese name of 936361-25-0? |
| A: Chinese name of 936361-25-0 is 936361-25-0. |
| Q: What is the polar surface area (PSA) of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-(2-methyl-1,3-thiazol-5-yl)carbamate is 82.95000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |