3-methyl-4-phenylsulfanylcyclohex-3-ene-1-carbonitrile structure
|
Common Name | 3-methyl-4-phenylsulfanylcyclohex-3-ene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 93604-51-4 | Molecular Weight | 229.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-4-phenylsulfanylcyclohex-3-ene-1-carbonitrile |
|---|
| Molecular Formula | C14H15NS |
|---|---|
| Molecular Weight | 229.34100 |
| Exact Mass | 229.09300 |
| PSA | 49.09000 |
| LogP | 4.37638 |
| InChIKey | MMWXKBVKLOLSOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(Sc2ccccc2)CCC(C#N)C1 |
|
~78%
3-methyl-4-phen... CAS#:93604-51-4 |
| Literature: Proteau, Philip J.; Hopkins, Paul B. Journal of Organic Chemistry, 1985 , vol. 50, # 1 p. 141 - 143 |
|
~%
3-methyl-4-phen... CAS#:93604-51-4 |
| Literature: Proteau, Philip J.; Hopkins, Paul B. Journal of Organic Chemistry, 1985 , vol. 50, # 1 p. 141 - 143 |