Propanoic acid,2-[3-methyl-4-(1-methylpropyl)phenoxy]-
Modify Date: 2025-09-19 21:22:39
![Propanoic acid,2-[3-methyl-4-(1-methylpropyl)phenoxy]- Structure](https://image.chemsrc.com/caspic/311/93570-95-7.png)
Propanoic acid,2-[3-methyl-4-(1-methylpropyl)phenoxy]- structure
|
Common Name | Propanoic acid,2-[3-methyl-4-(1-methylpropyl)phenoxy]- | ||
|---|---|---|---|---|
| CAS Number | 93570-95-7 | Molecular Weight | 236.30700 | |
| Density | 1.053g/cm3 | Boiling Point | 359.7ºC at 760mmHg | |
| Molecular Formula | C14H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | 2-(4-butan-2-yl-3-methylphenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.053g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760mmHg |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.30700 |
| Flash Point | 129.3ºC |
| Exact Mass | 236.14100 |
| PSA | 46.53000 |
| LogP | 3.36040 |
| Index of Refraction | 1.512 |
| InChIKey | DCIIVVHKTKERNJ-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(OC(C)C(=O)O)cc1C |
| HS Code | 2918990090 |
|---|
|
~%
Propanoic acid,... CAS#:93570-95-7 |
| Literature: Boots Pure Drug Co. Patent: GB916242 , 1963 ; Chem.Abstr., 1963 , vol. 59, # 5080 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-butan-2-yl-3-methyl-phenoxy)propanoic acid |