N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylmethanesulfonamide
Modify Date: 2025-09-30 16:29:42
![N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylmethanesulfonamide Structure](https://image.chemsrc.com/caspic/117/93501-65-6.png)
N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylmethanesulfonamide structure
|
Common Name | N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylmethanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 93501-65-6 | Molecular Weight | 274.34100 | |
| Density | 1.248g/cm3 | Boiling Point | 365ºC at 760mmHg | |
| Molecular Formula | C7H19N2O3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylmethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 365ºC at 760mmHg |
| Molecular Formula | C7H19N2O3PS2 |
| Molecular Weight | 274.34100 |
| Flash Point | 174.5ºC |
| Exact Mass | 274.05700 |
| PSA | 109.97000 |
| LogP | 3.20870 |
| Index of Refraction | 1.508 |
| InChIKey | ZPIJKCPQQBEQKV-UHFFFAOYSA-N |
| SMILES | CCC(C)SP(=O)(NC)N(C)S(C)(=O)=O |
|
~%
N-[butan-2-ylsu... CAS#:93501-65-6 |
| Literature: Rohm and Haas Company Patent: US4468388 A1, 1984 ; |
| N-methanesulfonyl |