2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzoic acid
Modify Date: 2025-08-25 19:44:13
2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzoic acid structure
|
Common Name | 2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 934665-14-2 | Molecular Weight | 393.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7F3INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzoic acid |
|---|
| Molecular Formula | C13H7F3INO2 |
|---|---|
| Molecular Weight | 393.10000 |
| Exact Mass | 392.94700 |
| PSA | 49.33000 |
| LogP | 4.22330 |
| InChIKey | UZZHOCXAACMGDB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)cc(F)cc1Nc1ccc(I)cc1F |
| HS Code | 2922499990 |
|---|
|
~58%
2,4-difluoro-6-... CAS#:934665-14-2 |
| Literature: EXELIXIS, INC. Patent: WO2008/124085 A2, 2008 ; Location in patent: Page/Page column 228 ; WO 2008/124085 A2 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |