3-(2-Chloro-4-nitrophenyl)-2-methyl-4(3H)-quinazolinone structure
|
Common Name | 3-(2-Chloro-4-nitrophenyl)-2-methyl-4(3H)-quinazolinone | ||
|---|---|---|---|---|
| CAS Number | 93432-37-2 | Molecular Weight | 315.71100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-chloro-4-nitrophenyl)-2-methylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10ClN3O3 |
|---|---|
| Molecular Weight | 315.71100 |
| Exact Mass | 315.04100 |
| PSA | 80.71000 |
| LogP | 3.77890 |
| InChIKey | CAPGDMLTAQKIHX-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc([N+](=O)[O-])cc1Cl |
| HS Code | 2933990090 |
|---|
|
~%
3-(2-Chloro-4-n... CAS#:93432-37-2 |
| Literature: Subbaram Proceedings - Indian Academy of Sciences, Section A, 1954 , # 40 p. 22 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Chloro-4-nitro-phenyl)-2-methyl-3H-quinazolin-4-one |
| 3-(2-Chloro-4-nitrophenyl)-2-methyl-4(3H)-quinazolinone |
| 4(3H)-Quinazolinone, 3-(2-chloro-4-nitrophenyl)-2-methyl- |