Benzoicacid, 4-chloro-, 2-(2-furanylmethylene)hydrazide
Modify Date: 2025-10-01 18:19:38
Benzoicacid, 4-chloro-, 2-(2-furanylmethylene)hydrazide structure
|
Common Name | Benzoicacid, 4-chloro-, 2-(2-furanylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 93418-01-0 | Molecular Weight | 248.66500 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-[(E)-furan-2-ylmethylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.66500 |
| Exact Mass | 248.03500 |
| PSA | 54.60000 |
| LogP | 3.08780 |
| Index of Refraction | 1.602 |
| InChIKey | UNVOTDGPNAVDAJ-RIYZIHGNSA-N |
| SMILES | O=C(NN=Cc1ccco1)c1ccc(Cl)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| T4925 |
| p-chlorobenzoylhydrazone of 2-furaldehyd |