3-(4,5-dimethoxy-2-nitro-phenyl)-2-phenyl-prop-2-enoic acid structure
|
Common Name | 3-(4,5-dimethoxy-2-nitro-phenyl)-2-phenyl-prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 93316-93-9 | Molecular Weight | 329.30400 | |
| Density | 1.333g/cm3 | Boiling Point | 505ºC at 760 mmHg | |
| Molecular Formula | C17H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | (Z)-3-(4,5-dimethoxy-2-nitrophenyl)-2-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 505ºC at 760 mmHg |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.30400 |
| Flash Point | 259.2ºC |
| Exact Mass | 329.09000 |
| PSA | 101.58000 |
| LogP | 3.76040 |
| Index of Refraction | 1.634 |
| InChIKey | YEGOYYAIIWDEQS-JYRVWZFOSA-N |
| SMILES | COc1cc(C=C(C(=O)O)c2ccccc2)c([N+](=O)[O-])cc1OC |
|
~%
3-(4,5-dimethox... CAS#:93316-93-9 |
| Literature: Pschorr; Buckow Chemische Berichte, 1900 , vol. 33, p. 1830 |
|
~%
3-(4,5-dimethox... CAS#:93316-93-9 |
| Literature: Luo, Yinggang; Tao, Feiyan; Liu, Yan; Li, Bogang; Zhang, Guolin Canadian Journal of Chemistry, 2006 , vol. 84, # 12 p. 1620 - 1625 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4,5-dihydroxy-3-methoxyphenyl)prop-2-enoic acid |
| 3-(3,4-dihydroxy-5-methoxyphenyl)acrylic acid |
| 4.5-Dimethoxy-2'-methoxymethyl-2-methyl-zimtsaeure-nitril |
| 5-Hydroxyferulic acid methyl ester |
| 3-Methoxy-4,5-dihydroxy-zimtsaeure |
| 3-(4,5-Dimethoxy-2-nitro-phenyl)-2-phenyl-acrylsaeure |
| 4,5-dihydroxy-3-methoxycinnamic acid |
| 3-(4,5-dimethoxy-2-nitro-phenyl)-2-phenyl-acrylic acid |
| 5-Hydroxyferulic acid |
| 3-(4,5-dimethoxy-2-methyl-phenyl)-2-methoxymethyl-acrylonitrile |
| 4,5-dimethoxy-2-methyl-2'-(methoxymethyl)cinnamonitrile |
| 4,5-Dihydroxy-3-methoxy-zimtsaeure (3-Methoxy-kaffeesaeure) |