Benzenesulfonic acid,2,4,5-trichloro-, 2-fluoroethyl ester
Modify Date: 2025-08-20 10:05:34
Benzenesulfonic acid,2,4,5-trichloro-, 2-fluoroethyl ester structure
|
Common Name | Benzenesulfonic acid,2,4,5-trichloro-, 2-fluoroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 93286-18-1 | Molecular Weight | 307.55400 | |
| Density | 1.574g/cm3 | Boiling Point | 407.1ºC at 760mmHg | |
| Molecular Formula | C8H6Cl3FO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | 2-fluoroethyl 2,4,5-trichlorobenzenesulfonate |
|---|
| Density | 1.574g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760mmHg |
| Molecular Formula | C8H6Cl3FO3S |
| Molecular Weight | 307.55400 |
| Flash Point | 200ºC |
| Exact Mass | 305.90900 |
| PSA | 51.75000 |
| LogP | 4.40240 |
| Index of Refraction | 1.538 |
| InChIKey | HBYMUZNHDQMVCS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCCF)c1cc(Cl)c(Cl)cc1Cl |
|
~76%
Benzenesulfonic... CAS#:93286-18-1 |
| Literature: Shealy, Y. Fulmer; Krauth, Charles A.; Struck, Robert F.; Montgomery, John A. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1168 - 1173 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |