1-ethoxycarbonyloxyethyl 2-propylpentanoate
Modify Date: 2024-09-20 21:10:30
1-ethoxycarbonyloxyethyl 2-propylpentanoate structure
|
Common Name | 1-ethoxycarbonyloxyethyl 2-propylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 93181-78-3 | Molecular Weight | 260.32700 | |
| Density | 1.012g/cm3 | Boiling Point | 308.1ºC at 760 mmHg | |
| Molecular Formula | C13H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.9ºC | |
| Name | 1-ethoxycarbonyloxyethyl 2-propylpentanoate |
|---|
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 308.1ºC at 760 mmHg |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.32700 |
| Flash Point | 128.9ºC |
| Exact Mass | 260.16200 |
| PSA | 61.83000 |
| LogP | 3.26510 |
| Index of Refraction | 1.437 |
| InChIKey | ZIJGGSZJPPURSY-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)C(=O)OC(C)OC(=O)OCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |