Acetamide,N,N'-[(tetramethyl-p-phenylene)dimethylene]bis- (6CI,7CI) structure
|
Common Name | Acetamide,N,N'-[(tetramethyl-p-phenylene)dimethylene]bis- (6CI,7CI) | ||
|---|---|---|---|---|
| CAS Number | 93142-38-2 | Molecular Weight | 276.37400 | |
| Density | 1.042g/cm3 | Boiling Point | 564ºC at 760mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
| Name | N-[[4-(acetamidomethyl)-2,3,5,6-tetramethylphenyl]methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 564ºC at 760mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 212.2ºC |
| Exact Mass | 276.18400 |
| PSA | 58.20000 |
| LogP | 2.97420 |
| Index of Refraction | 1.524 |
| InChIKey | ODWKBJHZGDBMPF-UHFFFAOYSA-N |
| SMILES | CC(=O)NCc1c(C)c(C)c(CNC(C)=O)c(C)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2,4,5-Tetramethyl-3,6-bis-acetaminomethyl-benzol |
| N,N'-Diacetyl-2,3,5,6-tetramethyl-1,4-di-<aminomethyl>-benzol |