(4-methoxyphenyl)methyl 3,5-dinitrobenzoate structure
|
Common Name | (4-methoxyphenyl)methyl 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 93141-01-6 | Molecular Weight | 332.26500 | |
| Density | 1.409g/cm3 | Boiling Point | 497.8ºC at 760mmHg | |
| Molecular Formula | C15H12N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.6ºC | |
| Name | (4-methoxyphenyl)methyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 497.8ºC at 760mmHg |
| Molecular Formula | C15H12N2O7 |
| Molecular Weight | 332.26500 |
| Flash Point | 215.6ºC |
| Exact Mass | 332.06400 |
| PSA | 127.17000 |
| LogP | 3.91500 |
| InChIKey | KMUVKZNHCBYRTL-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
|
~56%
(4-methoxypheny... CAS#:93141-01-6 |
| Literature: Amyes, Tina L.; Richard, John P. Journal of the American Chemical Society, 1990 , vol. 112, # 26 p. 9507 - 9512 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methoxybenzyl 3,5-dinitrobenzoate |