1,2,3-Oxadiazolium,3-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-hydroxy-, inner salt structure
|
Common Name | 1,2,3-Oxadiazolium,3-(1,3-benzodioxol-5-ylmethyl)-4-chloro-5-hydroxy-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 93116-38-2 | Molecular Weight | 254.62700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-chlorooxadiazol-3-ium-5-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7ClN2O4 |
|---|---|
| Molecular Weight | 254.62700 |
| Exact Mass | 254.00900 |
| PSA | 71.43000 |
| LogP | 1.53630 |
| InChIKey | VZMSYCKDTVLXBB-UHFFFAOYSA-N |
| SMILES | [O-]c1on[n+](Cc2ccc3c(c2)OCO3)c1Cl |
|
~%
1,2,3-Oxadiazol... CAS#:93116-38-2 |
| Literature: Nyberg; Cheng Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 531 - 533 |
|
~%
1,2,3-Oxadiazol... CAS#:93116-38-2 |
| Literature: Nyberg; Cheng Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 531 - 533 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-3-piperonyl-sydnon |
| 3-benzo[1,3]dioxol-5-ylmethyl-4-chloro-sydnone |