4-thiophen-3-yl-1,3-dihydroimidazole-2-thione structure
|
Common Name | 4-thiophen-3-yl-1,3-dihydroimidazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 93103-28-7 | Molecular Weight | 182.26600 | |
| Density | 1.46g/cm3 | Boiling Point | 315.7ºC at 760 mmHg | |
| Molecular Formula | C7H6N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.7ºC | |
| Name | 4-thiophen-3-yl-1,3-dihydroimidazole-2-thione |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 315.7ºC at 760 mmHg |
| Molecular Formula | C7H6N2S2 |
| Molecular Weight | 182.26600 |
| Flash Point | 144.7ºC |
| Exact Mass | 181.99700 |
| PSA | 95.72000 |
| LogP | 2.42690 |
| Index of Refraction | 1.751 |
| InChIKey | ANYGIRMHMQHXJY-UHFFFAOYSA-N |
| SMILES | S=c1[nH]cc(-c2ccsc2)[nH]1 |
|
~63%
4-thiophen-3-yl... CAS#:93103-28-7 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |