Benzenesulfonic acid, (4-pyridinylmethylene)hydrazide, monohydrochloride structure
|
Common Name | Benzenesulfonic acid, (4-pyridinylmethylene)hydrazide, monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 93061-74-6 | Molecular Weight | 297.76100 | |
| Density | 1.28g/cm3 | Boiling Point | 447.8ºC at 760 mmHg | |
| Molecular Formula | C12H12ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | N-[(E)-pyridin-4-ylmethylideneamino]benzenesulfonamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760 mmHg |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.76100 |
| Flash Point | 224.6ºC |
| Exact Mass | 297.03400 |
| PSA | 79.80000 |
| LogP | 3.66770 |
| Index of Refraction | 1.622 |
| InChIKey | XUWLGAWTWKOOLU-KMZJGFRYSA-N |
| SMILES | Cl.O=S(=O)(NN=Cc1ccncc1)c1ccccc1 |
|
~71%
Benzenesulfonic... CAS#:93061-74-6 |
| Literature: Shyam; Cosby; Sartorelli Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 149 - 152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonic acid,monohydrochloride |