N-Cbz-RS-Cyclohexylglycine
Modify Date: 2024-01-04 12:21:26
N-Cbz-RS-Cyclohexylglycine structure
|
Common Name | N-Cbz-RS-Cyclohexylglycine | ||
|---|---|---|---|---|
| CAS Number | 93025-71-9 | Molecular Weight | 291.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cyclohexaneacetic acid,a-[[(phenylmethoxy)carbonyl]amino] |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21NO4 |
|---|---|
| Molecular Weight | 291.34200 |
| Exact Mass | 291.14700 |
| PSA | 75.63000 |
| LogP | 3.33720 |
| InChIKey | CUSYTUPJAYLNFQ-UHFFFAOYSA-N |
| SMILES | O=C(NC(C(=O)O)C1CCCCC1)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-Cbz-RS-Cycloh... CAS#:93025-71-9 |
| Literature: Journal of the Chemical Society, , p. 1440 - 1444 |
|
~87%
N-Cbz-RS-Cycloh... CAS#:93025-71-9 |
| Literature: Ballini, Roberto; Petrini, Marino Tetrahedron Letters, 1999 , vol. 40, # 23 p. 4449 - 4452 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dl-phenylalanine,4-[bis(2-chloroethyl)amino]-,monohydrochloride |
| MELPHALAN raceMic Mixture |
| 4-[bis-(2-chloro-ethyl)-amino]-DL-phenylalanine,hydrochloride |
| Dl-alanine,3-(p-[bis(2-chloroethyl)amino]phenyl)-,hydrochloride |
| Alanine,3-[p-[bis(2-chloroethyl)amino]phenyl]-,monohydrochloride,DL |
| 4-[bis(2-chloroethyl)amino]-DL-phenylalanine monohydrochloride |
| Alanine,3-[p-[bis(2-chloroethyl)amino]phenyl]-,hydrochloride,DL |
| N-(benzyloxycarbonyl)cyclohexylglycine |
| Dl-phenylalanine mustard hydrochloride |
| sarcolysine |
| 4-[Bis-(2-chlor-aethyl)-amino]-DL-phenylalanin,Hydrochlorid |