WYE-175761 structure
|
Common Name | WYE-175761 | ||
|---|---|---|---|---|
| CAS Number | 92966-73-9 | Molecular Weight | 332.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WYE-175761CTP inhibitor; Inhibitor of the mitochondrial citrate transport protein; |
| Name | WYE-175761 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16N2O2S2 |
|---|---|
| Molecular Weight | 332.4 |
| InChIKey | HPZSZQVTMGNBSD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc3sc(C)nc3c2)cc1 |
| Benzenesulfonamide, N,4-dimethyl-N-(2-methyl-5-benzothiazolyl)- |