DL-Benzyloxycarbonylamino-[2-chlor-phenyl]-essigsaeure structure
|
Common Name | DL-Benzyloxycarbonylamino-[2-chlor-phenyl]-essigsaeure | ||
|---|---|---|---|---|
| CAS Number | 92874-69-6 | Molecular Weight | 319.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | DL-Benzyloxycarbonylamino-[2-chlor-phenyl]-essigsaeure |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14ClNO4 |
|---|---|
| Molecular Weight | 319.74000 |
| Exact Mass | 319.06100 |
| PSA | 75.63000 |
| LogP | 3.78300 |
| InChIKey | ZNORFUYPJLRGCK-UHFFFAOYSA-N |
| SMILES | O=C(NC(C(=O)O)c1ccccc1Cl)OCc1ccccc1 |
|
~%
DL-Benzyloxycar... CAS#:92874-69-6 |
| Literature: Doyle,F.P. et al. Journal of the Chemical Society, 1962 , p. 1440 - 1444 |
| DL-Benzyloxycarbonylamino-(2-chlor-phenyl)-essigsaeure |