KCN1
Modify Date: 2025-08-25 00:42:22
KCN1 structure
|
Common Name | KCN1 | ||
|---|---|---|---|---|
| CAS Number | 927823-01-6 | Molecular Weight | 465.56100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KCN1KCN1 (HIF inhibitor KCN1) is a small molecule inhibitor of the HIF-1 pathway, antagonizes HIF transcription in bioassay, blocks the p300/HIF-1α interaction, and exert potent anticancer activity in vitro and in vivo. |
| Name | 3,4-dimethoxy-N-[(2,2-dimethyl-2H-chromen-6-yl)methyl]-N-phenylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H27NO5S |
|---|---|
| Molecular Weight | 465.56100 |
| Exact Mass | 465.16100 |
| PSA | 73.45000 |
| LogP | 6.36430 |
| InChIKey | IPZJNJPAVPZHJM-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc3c(c2)C=CC(C)(C)O3)c2ccccc2)cc1OC |
| N-((2,2-dimethyl-2H-chromen-6-yl)methyl)-3,4-dimethoxy-N-phenylbenzenesulfonamide |
| KCN-1 |
| KCN1 |