Benzaldehyde, 4-[[6-amino-7,8-dihydro-2-(2-methoxyethoxy)-8-oxo-9H-purin-9-yl]methyl]- structure
|
Common Name | Benzaldehyde, 4-[[6-amino-7,8-dihydro-2-(2-methoxyethoxy)-8-oxo-9H-purin-9-yl]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 927822-45-5 | Molecular Weight | 343.33728 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzaldehyde, 4-[[6-amino-7,8-dihydro-2-(2-methoxyethoxy)-8-oxo-9H-purin-9-yl]methyl]-UC-1V150 is a specific TLR7 (Toll-like receptor) agonist that stimulates cellular immune responses and has anti-tumor activity. UC-1V150 can be used to synthesize ISAC (Immune-Stimulating Antibody Conjugates) molecule[1][2]. |
| Name | Benzaldehyde, 4-[[6-amino-7,8-dihydro-2-(2-methoxyethoxy)-8-oxo-9H-purin-9-yl]methyl]- |
|---|
| Description | UC-1V150 is a specific TLR7 (Toll-like receptor) agonist that stimulates cellular immune responses and has anti-tumor activity. UC-1V150 can be used to synthesize ISAC (Immune-Stimulating Antibody Conjugates) molecule[1][2]. |
|---|---|
| Related Catalog | |
| Target |
TLR7 |
| In Vitro | UC-1V150 (0.01-10 μM, 24 hour) can stimulate the release of IL-6 and IL-2 cytokines effectively in bone-marrow-derived macrophages[1]. UC-1V150 (1 μg/mL, 48 hours) can increase the expression of FcγRIIA and FcγRIII while inducing an approximately 1.5-fold increase in macrophage phagocytosis index of target cells in hman monocyte-derived macrophages (hMDM)[2]. |
| In Vivo | UC-1V150 (intravenous injection, 0.38-38 nM, once, 2 hours) effectively induces release of serum cytokines within a certain concentration range in female C57BL/6 mice (5-6 weeks of age)[1]. Animal Model: Female C57BL/6 mice (5–6 weeks of age)[1] Dosage: 0.38-38 nM Administration: Intravenous injection; once; 2 hours Result: Induced serum cytokine IL-6 levels about 0.1 ng/mL and IL-2 levels about 1.5 ng/mL at the concentration of 38 nM. |
| References |
| Molecular Formula | C16H17N5O4 |
|---|---|
| Molecular Weight | 343.33728 |
| InChIKey | SHNIBVWXUOEWTA-UHFFFAOYSA-N |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C=O)cc3)c2n1 |