Methyl 3-amino-4-isopropoxybenzoate
Modify Date: 2025-12-01 09:33:45
Methyl 3-amino-4-isopropoxybenzoate structure
|
Common Name | Methyl 3-amino-4-isopropoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 927802-56-0 | Molecular Weight | 209.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-amino-4-isopropoxybenzoate |
|---|
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24200 |
| Exact Mass | 209.10500 |
| PSA | 61.55000 |
| LogP | 2.42380 |
| InChIKey | CXEMBXXFMPWKTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC(C)C)c(N)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |