(2,3,4,5,6-pentafluorophenyl) 2-methylpyrazole-3-carboxylate
Modify Date: 2025-09-10 22:59:21
(2,3,4,5,6-pentafluorophenyl) 2-methylpyrazole-3-carboxylate structure
|
Common Name | (2,3,4,5,6-pentafluorophenyl) 2-methylpyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 926921-64-4 | Molecular Weight | 292.16200 | |
| Density | 1.57g/cm3 | Boiling Point | 87/4.5mm | |
| Molecular Formula | C11H5F5N2O2 | Melting Point | 42.5-44ºC | |
| MSDS | N/A | Flash Point | 200.5ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl) 2-methylpyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 87/4.5mm |
| Melting Point | 42.5-44ºC |
| Molecular Formula | C11H5F5N2O2 |
| Molecular Weight | 292.16200 |
| Flash Point | 200.5ºC |
| Exact Mass | 292.02700 |
| PSA | 44.12000 |
| LogP | 2.33480 |
| Index of Refraction | 1.521 |
| InChIKey | LFLXSDHHZKOTLP-UHFFFAOYSA-N |
| SMILES | Cn1nccc1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [2,3,4,5,6-pentakis(fluoranyl)phenyl] 2-methylpyrazole-3-carboxylate |
| Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate |
| pentafluorophenyl 2-methylpyrazole-3-carboxylate |