Cyclopropanecarboxylic acid, 1-(3-methoxy-4-methylphenyl) structure
|
Common Name | Cyclopropanecarboxylic acid, 1-(3-methoxy-4-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 926209-30-5 | Molecular Weight | 206.23800 | |
| Density | 1.224±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 365.4±37.0 °C (760 mmHg) | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cyclopropanecarboxylic acid, 1-(3-methoxy-4-methylphenyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 365.4±37.0 °C (760 mmHg) |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 2.11980 |
| InChIKey | WHSRBWOFSUGSHR-UHFFFAOYSA-N |
| SMILES | COc1cc(C2(C(=O)O)CC2)ccc1C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(3-methoxy-4-methylphenyl)cyclopropane-1-carboxylic acid |