2,6-dibromo-9,9-dimethylfluorene structure
|
Common Name | 2,6-dibromo-9,9-dimethylfluorene | ||
|---|---|---|---|---|
| CAS Number | 925889-85-6 | Molecular Weight | 352.06400 | |
| Density | 1.606g/cm3 | Boiling Point | 392.1ºC at 760 mmHg | |
| Molecular Formula | C15H12Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 2,6-dibromo-9,9-dimethylfluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.606g/cm3 |
|---|---|
| Boiling Point | 392.1ºC at 760 mmHg |
| Molecular Formula | C15H12Br2 |
| Molecular Weight | 352.06400 |
| Flash Point | 223.4ºC |
| Exact Mass | 349.93100 |
| LogP | 5.51790 |
| Index of Refraction | 1.635 |
| InChIKey | ASUQXIDYMVXFKU-UHFFFAOYSA-N |
| SMILES | CC1(C)c2ccc(Br)cc2-c2ccc(Br)cc21 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-bis(bromanyl)-9,9-dimethyl-fluorene |
| 2,6-Dibromo-9,9-dimethyl-9H-fluorene |