methyl 5-methoxy-2-phenylpyrazole-3-carboxylate
Modify Date: 2025-08-30 18:46:57
methyl 5-methoxy-2-phenylpyrazole-3-carboxylate structure
|
Common Name | methyl 5-methoxy-2-phenylpyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 92576-30-2 | Molecular Weight | 232.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-methoxy-2-phenylpyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O3 |
|---|---|
| Molecular Weight | 232.23500 |
| Exact Mass | 232.08500 |
| PSA | 53.35000 |
| LogP | 1.66750 |
| InChIKey | VHCGPFOCABZQDR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)nn1-c1ccccc1 |
|
~64%
methyl 5-methox... CAS#:92576-30-2 |
| Literature: Mahajan; Havaldar; Fernandes Journal of the Indian Chemical Society, 1991 , vol. 68, # 4 p. 245 - 246 |
| 5-methoxy-2-phenyl-2H-pyrazole-3-carboxylic acid methyl ester |
| 1-Phenyl-3-methoxy-pyrazol-5-carbonsaeure-methylester |
| 1H-Pyrazole-5-carboxylic acid,3-methoxy-1-phenyl-,methyl ester |
| methyl 3-methoxy-1-phenyl-1H-pyrazole-5-carboxylate |