8-nitro-2-phenyl-quinoline-4-carboxylic acid structure
|
Common Name | 8-nitro-2-phenyl-quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 92566-37-5 | Molecular Weight | 294.26200 | |
| Density | 1.425g/cm3 | Boiling Point | 524.5ºC at 760mmHg | |
| Molecular Formula | C16H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271ºC | |
| Name | 8-nitro-2-phenylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 524.5ºC at 760mmHg |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.26200 |
| Flash Point | 271ºC |
| Exact Mass | 294.06400 |
| PSA | 96.01000 |
| LogP | 4.03140 |
| InChIKey | ZPBCZAOGVIOUQA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)nc2c([N+](=O)[O-])cccc12 |
|
~%
8-nitro-2-pheny... CAS#:92566-37-5 |
| Literature: Buchman et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 380,381 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-nitro-2-phenyl-quinoline-4-carboxylic acid |
| 8-Nitro-2-phenyl-chinolin-4-carbonsaeure |
| 2-phenyl-8-nitroquinoline-4-carboxylic acid |