6-ethyl-2-methylquinoline-3-carboxylic acid structure
|
Common Name | 6-ethyl-2-methylquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 92513-36-5 | Molecular Weight | 215.24800 | |
| Density | 1.206g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 175.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-ethyl-2-methylquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 175.9ºC |
| Exact Mass | 215.09500 |
| PSA | 50.19000 |
| LogP | 2.80380 |
| Index of Refraction | 1.63 |
| InChIKey | WZUBVPVDDWQDFN-UHFFFAOYSA-N |
| SMILES | CCc1ccc2nc(C)c(C(=O)O)cc2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 3-Quinolinecarboxylic acid,6-ethyl-2-methyl |
| QU110 |