1-(4-hydroxy-3-piperidin-1-ylmethyl-phenyl)-ethanone structure
|
Common Name | 1-(4-hydroxy-3-piperidin-1-ylmethyl-phenyl)-ethanone | ||
|---|---|---|---|---|
| CAS Number | 92500-17-9 | Molecular Weight | 233.30600 | |
| Density | N/A | Boiling Point | 396.6ºC at 760mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 1-(4-hydroxy-3-piperidin-1-ylmethyl-phenyl)-ethanone |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 396.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 193.6ºC |
| Exact Mass | 233.14200 |
| PSA | 40.54000 |
| LogP | 2.51860 |
| InChIKey | GHFAMDMJBIXKPC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c(CN2CCCCC2)c1 |
| HS Code | 2933399090 |
|---|
|
~68%
1-(4-hydroxy-3-... CAS#:92500-17-9 |
| Literature: Borthakur, R. C.; Borthakur, N.; Rastogi, R. C. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 3 p. 244 - 248 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Phenyl-2,4-quinolinediol |
| 2,4-quinolinediol,3-phenyl |
| 2,4-Dihydroxy-3-phenylquinoline |
| 4-hydroxy-3-phenylquinolin-2(1H)-one |
| 4-Hydroxy-3-piperidinomethyl-acetophenon |
| 4-hydroxy-3-phenyl-2(1H)-quinolone |