4-[2-(6-Methyl-2-pyridinyl)-2-oxoethyl]-6-quinolinecarbonitrile structure
|
Common Name | 4-[2-(6-Methyl-2-pyridinyl)-2-oxoethyl]-6-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 924898-11-3 | Molecular Weight | 287.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(6-Methyl-2-pyridinyl)-2-oxoethyl]-6-quinolinecarbonitrile |
|---|
| Molecular Formula | C18H13N3O |
|---|---|
| Molecular Weight | 287.31500 |
| Exact Mass | 287.10600 |
| PSA | 66.64000 |
| LogP | 3.23528 |
| InChIKey | KRFSUGPZCQQFPS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)Cc2ccnc3ccc(C#N)cc23)n1 |
|
~80%
4-[2-(6-Methyl-... CAS#:924898-11-3 |
| Literature: ELI LILLY AND COMPANY Patent: WO2007/18818 A1, 2007 ; Location in patent: Page/Page column 11 ; WO 2007/018818 A1 |
|
~%
4-[2-(6-Methyl-... CAS#:924898-11-3 |
| Literature: ELI LILLY AND COMPANY Patent: WO2007/18818 A1, 2007 ; Location in patent: Page/Page column 9 ; WO 2007/018818 A1 |