6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine
Modify Date: 2025-08-25 19:07:31
6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine structure
|
Common Name | 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine | ||
|---|---|---|---|---|
| CAS Number | 92436-45-8 | Molecular Weight | 295.16100 | |
| Density | 1.328g/cm3 | Boiling Point | 452.645ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.56ºC | |
| Name | 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 452.645ºC at 760 mmHg |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.16100 |
| Flash Point | 173.56ºC |
| Exact Mass | 294.02100 |
| PSA | 18.46000 |
| LogP | 4.68660 |
| Index of Refraction | 1.601 |
| InChIKey | LTQPRHNCZQSHRA-UHFFFAOYSA-N |
| SMILES | ClCc1cc(Cl)cc2c1OC(c1ccccc1)OC2 |
| HS Code | 2932999099 |
|---|
|
~%
6-Chloro-8-(chl... CAS#:92436-45-8 |
| Literature: Ziegler Chemische Berichte, 1944 , vol. 77/79, p. 731,734 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-8-chlormethyl-2-phenyl-benzo-1.3-dioxan |
| 6-CHLORO-8-CHLOROMETHYL-2-PHENYL-4H-BENZO[1,3]DIOXINE |
| 6-chloro-8-chloromethyl-2-phenyl-4H-benzo[1,3]dioxin |
| 6-Chlor-8-chlormethyl-2-phenyl-4H-benzo[1,3]dioxin |