4-Thiazolidinone,3-phenyl-5-(4-pyridinylmethylene)-2-thioxo-
Modify Date: 2024-09-13 16:51:54
4-Thiazolidinone,3-phenyl-5-(4-pyridinylmethylene)-2-thioxo- structure
|
Common Name | 4-Thiazolidinone,3-phenyl-5-(4-pyridinylmethylene)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 92427-61-7 | Molecular Weight | 298.38300 | |
| Density | 1.44g/cm3 | Boiling Point | 467.9ºC at 760mmHg | |
| Molecular Formula | C15H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Name | (5E)-3-phenyl-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 467.9ºC at 760mmHg |
| Molecular Formula | C15H10N2OS2 |
| Molecular Weight | 298.38300 |
| Flash Point | 236.8ºC |
| Exact Mass | 298.02300 |
| PSA | 90.59000 |
| LogP | 3.55240 |
| Index of Refraction | 1.758 |
| InChIKey | XSUKSJVVNSZBQG-JLHYYAGUSA-N |
| SMILES | O=C1C(=Cc2ccncc2)SC(=S)N1c1ccccc1 |
|
~%
4-Thiazolidinon... CAS#:92427-61-7 |
| Literature: Allan et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 112,113 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Phenyl-5-pyridin-4-ylmethylene-2-thioxo-thiazolidin-4-one |
| 3-phenyl-5-(4-pyridinylmethylene)-2-thioxo-1,3-thiazolidin-4-one |
| 3-Phenyl-5-[4]pyridylmethylen-2-thioxo-thiazolidin-4-on |
| 3-phenyl-5-[4]pyridylmethylene-2-thioxo-thiazolidin-4-one |