5-Isobenzofurancarboxamide,1,3-dihydro-1,3-dioxo-N-phenyl- structure
|
Common Name | 5-Isobenzofurancarboxamide,1,3-dihydro-1,3-dioxo-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 92424-72-1 | Molecular Weight | 267.23600 | |
| Density | 1.472g/cm3 | Boiling Point | 407.2ºC at 760mmHg | |
| Molecular Formula | C15H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | 1,3-dioxo-N-phenyl-2-benzofuran-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 407.2ºC at 760mmHg |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.23600 |
| Flash Point | 200ºC |
| Exact Mass | 267.05300 |
| PSA | 72.47000 |
| LogP | 2.32250 |
| Index of Refraction | 1.701 |
| InChIKey | JAWJPMDWGCFVLO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1ccc2c(c1)C(=O)OC2=O |
|
~%
5-Isobenzofuran... CAS#:92424-72-1 |
| Literature: Odell, Luke R.; Howan, Dian; Gordon, Christopher P.; Robertson, Mark J.; Chau, Ngoc; Mariana, Anna; Whiting, Ainslie E.; Abagyan, Ruben; Daniel, James A.; Gorgani, Nick N.; Robinson, Phillip J.; McCluskey, Adam Journal of Medicinal Chemistry, 2010 , vol. 53, # 14 p. 5267 - 5280 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-dioxo-N-phenyl-1,3-dihydroisobenzofuran-5-carboxamide |