iso-butyl ester of febuxostat structure
|
Common Name | iso-butyl ester of febuxostat | ||
|---|---|---|---|---|
| CAS Number | 923942-36-3 | Molecular Weight | 372.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | iso-butyl ester of febuxostat |
|---|
| Molecular Formula | C20H24N2O3S |
|---|---|
| Molecular Weight | 372.48100 |
| Exact Mass | 372.15100 |
| PSA | 100.45000 |
| LogP | 4.83778 |
| InChIKey | PQNXJXSGFRHJPV-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)OCC(C)C |