5-Bromo-4-methyl-N-nitropyridin-2-amine
Modify Date: 2025-08-23 12:45:01
5-Bromo-4-methyl-N-nitropyridin-2-amine structure
|
Common Name | 5-Bromo-4-methyl-N-nitropyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 923929-10-6 | Molecular Weight | 232.03500 | |
| Density | 1.773 | Boiling Point | 332.4ºC at 760 mmHg | |
| Molecular Formula | C6H6BrN3O2 | Melting Point | 162ºC | |
| MSDS | N/A | Flash Point | 154.8ºC | |
| Name | N-(5-bromo-4-methylpyridin-2-yl)nitramide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.773 |
|---|---|
| Boiling Point | 332.4ºC at 760 mmHg |
| Melting Point | 162ºC |
| Molecular Formula | C6H6BrN3O2 |
| Molecular Weight | 232.03500 |
| Flash Point | 154.8ºC |
| Exact Mass | 230.96400 |
| PSA | 70.74000 |
| LogP | 2.35230 |
| Index of Refraction | 1.652 |
| InChIKey | KQIBJJQDCWPIKH-UHFFFAOYSA-N |
| SMILES | Cc1cc(N[N+](=O)[O-])ncc1Br |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-BROMO-4-METHYL-N-NITROPYRIDINE-2-AMINE |
| QC-6653 |
| 5-Bromo-4-methyl-N-nitropyridin-2-amine |