Acetic acid, 2-cyano-,2-[[4-[bis(2-chloroethyl)amino]phenyl]methylene]hydrazide structure
|
Common Name | Acetic acid, 2-cyano-,2-[[4-[bis(2-chloroethyl)amino]phenyl]methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 92298-18-5 | Molecular Weight | 327.20900 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-cyanoacetamide |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.20900 |
| Exact Mass | 326.07000 |
| PSA | 68.49000 |
| LogP | 2.72528 |
| Index of Refraction | 1.573 |
| InChIKey | KCZPQAYIPLBOJY-WQRHYEAKSA-N |
| SMILES | N#CCC(=O)NN=Cc1ccc(N(CCCl)CCCl)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
Acetic acid, 2-... CAS#:92298-18-5 |
| Literature: Popp,F.D. Journal of Organic Chemistry, 1961 , vol. 26, p. 3019 - 3020 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |