acenaphthen-5-yl acetate structure
|
Common Name | acenaphthen-5-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 92253-99-1 | Molecular Weight | 212.24400 | |
| Density | 1.23g/cm3 | Boiling Point | 366.8ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124ºC | |
| Name | 1,2-dihydroacenaphthylen-5-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 366.8ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 124ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 2.86370 |
| Index of Refraction | 1.65 |
| InChIKey | XTUDZNCYMAXCDI-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2c3c(cccc13)CC2 |
|
~91%
acenaphthen-5-y... CAS#:92253-99-1 |
| Literature: Bezuglov; Minyaeva; Mezheritskii Russian Journal of Organic Chemistry, 2008 , vol. 44, # 3 p. 353 - 357 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| ACENAPHTHEN-5-YL ACETATE |
| 5-Acetoxy-acenaphthen |